C16H24O3 — CID 62930718
3,3-dimethyl-5-(4-propan-2-yloxyphenyl)pentanoic acid (PubChem CID 62930718) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3,3-dimethyl-5-(4-propan-2-yloxyphenyl)pentanoic acid.
| Compound Name | 3,3-dimethyl-5-(4-propan-2-yloxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 62930718 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3,3-dimethyl-5-(4-propan-2-yloxyphenyl)pentanoic acid |
| SMILES | CC(C)Oc1ccc(CCC(C)(C)CC(=O)O)cc1 |
| InChI | InChI=1S/C16H24O3/c1-12(2)19-14-7-5-13(6-8-14)9-10-16(3,4)11-15(17)18/h5-8,12H,9-11H2,1-4H3,(H,17,18) |
| InChIKey | VZVPFEABMGGQCZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |