About N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine
N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine (PubChem CID 62930834) has the molecular formula C15H30N2O
and a molecular weight of 254.42 g/mol. Its IUPAC name is N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine |
| PubChem CID | 62930834 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine |
| SMILES | CC(NCCN1CCC(C)(C)CC1)C1CCCO1 |
| InChI | InChI=1S/C15H30N2O/c1-13(14-5-4-12-18-14)16-8-11-17-9-6-15(2,3)7-10-17/h13-14,16H,4-12H2,1-3H3 |
| InChIKey | MYRGTWIKBBHVRS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine?
The IUPAC name of N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine (CID 62930834) is N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine.
What is the SMILES notation for N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine?
The canonical SMILES for N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine is CC(NCCN1CCC(C)(C)CC1)C1CCCO1.
What is the InChIKey of N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine?
The InChIKey is MYRGTWIKBBHVRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30N2O/c1-13(14-5-4-12-18-14)16-8-11-17-9-6-15(2,3)7-10-17/h13-14,16H,4-12H2,1-3H3.
What are the key properties of N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine?
N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine has a molecular weight of 254.42 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4,4-dimethylpiperidin-1-yl)ethyl]-1-(oxolan-2-yl)ethanamine is sourced from PubChem (CID 62930834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).