About 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one
1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one (PubChem CID 62931262) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one |
| PubChem CID | 62931262 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one |
| SMILES | CCNC(C)(C)C(=O)N1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H26N2O/c1-6-14-13(4,5)11(16)15-9-7-12(2,3)8-10-15/h14H,6-10H2,1-5H3 |
| InChIKey | MKEQCVRMYXQACA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one?
The IUPAC name of 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one (CID 62931262) is 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one.
What is the SMILES notation for 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one?
The canonical SMILES for 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one is CCNC(C)(C)C(=O)N1CCC(C)(C)CC1.
What is the InChIKey of 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one?
The InChIKey is MKEQCVRMYXQACA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O/c1-6-14-13(4,5)11(16)15-9-7-12(2,3)8-10-15/h14H,6-10H2,1-5H3.
What are the key properties of 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one?
1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one has a molecular weight of 226.36 g/mol, XLogP of 2.02, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylpiperidin-1-yl)-2-(ethylamino)-2-methylpropan-1-one is sourced from PubChem (CID 62931262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).