C10H18N4S — CID 62931950
3-(4,4-dimethylpiperidin-1-yl)-4-methyl-1H-1,2,4-triazole-5-thione (PubChem CID 62931950) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is 3-(4,4-dimethylpiperidin-1-yl)-4-methyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(4,4-dimethylpiperidin-1-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62931950 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 3-(4,4-dimethylpiperidin-1-yl)-4-methyl-1H-1,2,4-triazole-5-thione |
| SMILES | Cn1c(N2CCC(C)(C)CC2)n[nH]c1=S |
| InChI | InChI=1S/C10H18N4S/c1-10(2)4-6-14(7-5-10)8-11-12-9(15)13(8)3/h4-7H2,1-3H3,(H,12,15) |
| InChIKey | WZZZSFQWIHOHNS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|