C18H20N6 — CID 629324
4-N,6-N-diphenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine (PubChem CID 629324) has the molecular formula C18H20N6 and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-N,6-N-diphenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diphenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 629324 |
| Molecular Formula | C18H20N6 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-N,6-N-diphenyl-2-N-propan-2-yl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H20N6/c1-13(2)19-16-22-17(20-14-9-5-3-6-10-14)24-18(23-16)21-15-11-7-4-8-12-15/h3-13H,1-2H3,(H3,19,20,21,22,23,24) |
| InChIKey | XDHYXZYJYANQCH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |