C16H20N2O3 — CID 62932844
5-[1-(4-cyanophenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 62932844) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 5-[1-(4-cyanophenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[1-(4-cyanophenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62932844 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 5-[1-(4-cyanophenyl)ethylamino]-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(NC(=O)CC(C)(C)CC(=O)O)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H20N2O3/c1-11(13-6-4-12(10-17)5-7-13)18-14(19)8-16(2,3)9-15(20)21/h4-7,11H,8-9H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | UWSZJVSJFDLOFL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |