About 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione
1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione (PubChem CID 62932936) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione.
Molecular Properties
| Compound Name | 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione |
| PubChem CID | 62932936 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione |
| SMILES | CC1CC(=O)N(c2cc(N)ccc2Cl)C(=O)C1 |
| InChI | InChI=1S/C12H13ClN2O2/c1-7-4-11(16)15(12(17)5-7)10-6-8(14)2-3-9(10)13/h2-3,6-7H,4-5,14H2,1H3 |
| InChIKey | GPZJROJVUDRGAK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione?
The IUPAC name of 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione (CID 62932936) is 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione.
What is the SMILES notation for 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione?
The canonical SMILES for 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione is CC1CC(=O)N(c2cc(N)ccc2Cl)C(=O)C1.
What is the InChIKey of 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione?
The InChIKey is GPZJROJVUDRGAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2O2/c1-7-4-11(16)15(12(17)5-7)10-6-8(14)2-3-9(10)13/h2-3,6-7H,4-5,14H2,1H3.
What are the key properties of 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione?
1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione has a molecular weight of 252.70 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-2-chlorophenyl)-4-methylpiperidine-2,6-dione is sourced from PubChem (CID 62932936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).