About 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide
5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide (PubChem CID 62933145) has the molecular formula C13H22N2OS
and a molecular weight of 254.40 g/mol. Its IUPAC name is 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide.
Molecular Properties
| Compound Name | 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide |
| PubChem CID | 62933145 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide |
| SMILES | Cc1cc(C(N)CC(C)(C)CC(N)=O)c(C)s1 |
| InChI | InChI=1S/C13H22N2OS/c1-8-5-10(9(2)17-8)11(14)6-13(3,4)7-12(15)16/h5,11H,6-7,14H2,1-4H3,(H2,15,16) |
| InChIKey | SZDIZQIVLXEQQX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide?
The IUPAC name of 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide (CID 62933145) is 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide.
What is the SMILES notation for 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide?
The canonical SMILES for 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide is Cc1cc(C(N)CC(C)(C)CC(N)=O)c(C)s1.
What is the InChIKey of 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide?
The InChIKey is SZDIZQIVLXEQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2OS/c1-8-5-10(9(2)17-8)11(14)6-13(3,4)7-12(15)16/h5,11H,6-7,14H2,1-4H3,(H2,15,16).
What are the key properties of 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide?
5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide has a molecular weight of 254.40 g/mol, XLogP of 2.66, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-5-(2,5-dimethylthiophen-3-yl)-3,3-dimethylpentanamide is sourced from PubChem (CID 62933145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).