C15H23NO4 — CID 62933457
4-ethyl-1-(4-methyl-2,6-dioxopiperidin-1-yl)cyclohexane-1-carboxylic acid (PubChem CID 62933457) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-ethyl-1-(4-methyl-2,6-dioxopiperidin-1-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-ethyl-1-(4-methyl-2,6-dioxopiperidin-1-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 62933457 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-ethyl-1-(4-methyl-2,6-dioxopiperidin-1-yl)cyclohexane-1-carboxylic acid |
| SMILES | CCC1CCC(C(=O)O)(N2C(=O)CC(C)CC2=O)CC1 |
| InChI | InChI=1S/C15H23NO4/c1-3-11-4-6-15(7-5-11,14(19)20)16-12(17)8-10(2)9-13(16)18/h10-11H,3-9H2,1-2H3,(H,19,20) |
| InChIKey | MQTBKIADKOQOSA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|