C16H24O4 — CID 62934715
1,2,3-trimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-ol (PubChem CID 62934715) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is 1,2,3-trimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-ol.
| Compound Name | 1,2,3-trimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 62934715 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1,2,3-trimethoxy-7,7-dimethyl-5,6,8,9-tetrahydrobenzo[7]annulen-5-ol |
| SMILES | COc1cc2c(c(OC)c1OC)CCC(C)(C)CC2O |
| InChI | InChI=1S/C16H24O4/c1-16(2)7-6-10-11(12(17)9-16)8-13(18-3)15(20-5)14(10)19-4/h8,12,17H,6-7,9H2,1-5H3 |
| InChIKey | OSOCQJNTRVBHIE-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |