C15H16FN3O2 — CID 62936138
2-[3-(4-fluorophenyl)-2-oxopropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62936138) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)-2-oxopropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[3-(4-fluorophenyl)-2-oxopropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62936138 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 2-[3-(4-fluorophenyl)-2-oxopropyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=C(Cc1ccc(F)cc1)Cn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C15H16FN3O2/c16-12-6-4-11(5-7-12)9-13(20)10-19-15(21)18-8-2-1-3-14(18)17-19/h4-7H,1-3,8-10H2 |
| InChIKey | RWQIBCFIKGOEGS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |