About 2-(4,4-dimethylpiperidin-1-yl)ethanamine
2-(4,4-dimethylpiperidin-1-yl)ethanamine (PubChem CID 62936164) has the molecular formula C9H20N2
and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-(4,4-dimethylpiperidin-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4,4-dimethylpiperidin-1-yl)ethanamine |
| PubChem CID | 62936164 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2-(4,4-dimethylpiperidin-1-yl)ethanamine |
| SMILES | CC1(C)CCN(CCN)CC1 |
| InChI | InChI=1S/C9H20N2/c1-9(2)3-6-11(7-4-9)8-5-10/h3-8,10H2,1-2H3 |
| InChIKey | NHCRTTOTVRWPPF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4,4-dimethylpiperidin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dimethylpiperidin-1-yl)ethanamine?
The IUPAC name of 2-(4,4-dimethylpiperidin-1-yl)ethanamine (CID 62936164) is 2-(4,4-dimethylpiperidin-1-yl)ethanamine.
What is the SMILES notation for 2-(4,4-dimethylpiperidin-1-yl)ethanamine?
The canonical SMILES for 2-(4,4-dimethylpiperidin-1-yl)ethanamine is CC1(C)CCN(CCN)CC1.
What is the InChIKey of 2-(4,4-dimethylpiperidin-1-yl)ethanamine?
The InChIKey is NHCRTTOTVRWPPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2/c1-9(2)3-6-11(7-4-9)8-5-10/h3-8,10H2,1-2H3.
What are the key properties of 2-(4,4-dimethylpiperidin-1-yl)ethanamine?
2-(4,4-dimethylpiperidin-1-yl)ethanamine has a molecular weight of 156.27 g/mol, XLogP of 1.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dimethylpiperidin-1-yl)ethanamine is sourced from PubChem (CID 62936164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).