About 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile
4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile (PubChem CID 62936415) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile |
| PubChem CID | 62936415 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile |
| SMILES | CC1CCCN(c2ccnc(C#N)c2)C1C |
| InChI | InChI=1S/C13H17N3/c1-10-4-3-7-16(11(10)2)13-5-6-15-12(8-13)9-14/h5-6,8,10-11H,3-4,7H2,1-2H3 |
| InChIKey | QAEUSOQWCLUWSL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile?
The IUPAC name of 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile (CID 62936415) is 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile.
What is the SMILES notation for 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile?
The canonical SMILES for 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile is CC1CCCN(c2ccnc(C#N)c2)C1C.
What is the InChIKey of 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile?
The InChIKey is QAEUSOQWCLUWSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3/c1-10-4-3-7-16(11(10)2)13-5-6-15-12(8-13)9-14/h5-6,8,10-11H,3-4,7H2,1-2H3.
What are the key properties of 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile?
4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile has a molecular weight of 215.30 g/mol, XLogP of 2.58, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylpiperidin-1-yl)pyridine-2-carbonitrile is sourced from PubChem (CID 62936415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).