C13H15BFN3O3 — CID 62936487
[2-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]boronic acid (PubChem CID 62936487) has the molecular formula C13H15BFN3O3 and a molecular weight of 291.09 g/mol. Its IUPAC name is [2-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]boronic acid.
| Compound Name | [2-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 62936487 |
| Molecular Formula | C13H15BFN3O3 |
| Molecular Weight | 291.09 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | [2-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)methyl]phenyl]boronic acid |
| SMILES | O=c1n(Cc2ccc(F)c(B(O)O)c2)nc2n1CCCC2 |
| InChI | InChI=1S/C13H15BFN3O3/c15-11-5-4-9(7-10(11)14(20)21)8-18-13(19)17-6-2-1-3-12(17)16-18/h4-5,7,20-21H,1-3,6,8H2 |
| InChIKey | FBSJFCUBYGVTNS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.09 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|