C15H21N5O — CID 62936826
2-[[2-(propylamino)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62936826) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 2-[[2-(propylamino)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[[2-(propylamino)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62936826 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 2-[[2-(propylamino)-3-pyridinyl]methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | CCCNc1ncccc1Cn1nc2n(c1=O)CCCC2 |
| InChI | InChI=1S/C15H21N5O/c1-2-8-16-14-12(6-5-9-17-14)11-20-15(21)19-10-4-3-7-13(19)18-20/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,16,17) |
| InChIKey | TWZSAYHXHDLONH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |