C14H14FN3O2 — CID 62936992
2-[2-(3-fluorophenyl)-2-oxoethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 62936992) has the molecular formula C14H14FN3O2 and a molecular weight of 275.28 g/mol. Its IUPAC name is 2-[2-(3-fluorophenyl)-2-oxoethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 62936992 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-[2-(3-fluorophenyl)-2-oxoethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=C(Cn1nc2n(c1=O)CCCC2)c1cccc(F)c1 |
| InChI | InChI=1S/C14H14FN3O2/c15-11-5-3-4-10(8-11)12(19)9-18-14(20)17-7-2-1-6-13(17)16-18/h3-5,8H,1-2,6-7,9H2 |
| InChIKey | MEIWXBHBYNNHIF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |