C15H16N4O2 — CID 62937510
4-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethoxy]benzonitrile (PubChem CID 62937510) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethoxy]benzonitrile.
| Compound Name | 4-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 62937510 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 4-[2-(3-oxo-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCn2nc3n(c2=O)CCCC3)cc1 |
| InChI | InChI=1S/C15H16N4O2/c16-11-12-4-6-13(7-5-12)21-10-9-19-15(20)18-8-2-1-3-14(18)17-19/h4-7H,1-3,8-10H2 |
| InChIKey | GHKSNPQLGOWCCY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |