About [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine
[2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine (PubChem CID 62937783) has the molecular formula C15H24N2O2S
and a molecular weight of 296.44 g/mol. Its IUPAC name is [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine.
Molecular Properties
| Compound Name | [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine |
| PubChem CID | 62937783 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine |
| SMILES | CC1(C)CCN(S(=O)(=O)Cc2ccccc2CN)CC1 |
| InChI | InChI=1S/C15H24N2O2S/c1-15(2)7-9-17(10-8-15)20(18,19)12-14-6-4-3-5-13(14)11-16/h3-6H,7-12,16H2,1-2H3 |
| InChIKey | DRLJOZFLOAAKMV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine?
The IUPAC name of [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine (CID 62937783) is [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine.
What is the SMILES notation for [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine?
The canonical SMILES for [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine is CC1(C)CCN(S(=O)(=O)Cc2ccccc2CN)CC1.
What is the InChIKey of [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine?
The InChIKey is DRLJOZFLOAAKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2S/c1-15(2)7-9-17(10-8-15)20(18,19)12-14-6-4-3-5-13(14)11-16/h3-6H,7-12,16H2,1-2H3.
What are the key properties of [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine?
[2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine has a molecular weight of 296.44 g/mol, XLogP of 2.10, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4,4-dimethylpiperidin-1-yl)sulfonylmethyl]phenyl]methanamine is sourced from PubChem (CID 62937783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).