About 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide
2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide (PubChem CID 62938265) has the molecular formula C12H20N4O2
and a molecular weight of 252.32 g/mol. Its IUPAC name is 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide |
| PubChem CID | 62938265 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNc1nccn(C(C)(C)C)c1=O |
| InChI | InChI=1S/C12H20N4O2/c1-12(2,3)16-7-6-13-10(11(16)18)14-8-9(17)15(4)5/h6-7H,8H2,1-5H3,(H,13,14) |
| InChIKey | GXGWCMFNPGQEAV-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide (CID 62938265) is 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide is CN(C)C(=O)CNc1nccn(C(C)(C)C)c1=O.
What is the InChIKey of 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide?
The InChIKey is GXGWCMFNPGQEAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O2/c1-12(2,3)16-7-6-13-10(11(16)18)14-8-9(17)15(4)5/h6-7H,8H2,1-5H3,(H,13,14).
What are the key properties of 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide?
2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide has a molecular weight of 252.32 g/mol, XLogP of 0.50, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-tert-butyl-3-oxopyrazin-2-yl)amino]-N,N-dimethylacetamide is sourced from PubChem (CID 62938265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).