2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid

C8H10N2O3S — CID 62938587

IUPAC2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid
SMILESCCn1ccnc(SCC(=O)O)c1=O
InChIInChI=1S/C8H10N2O3S/c1-2-10-4-3-9-7(8(10)13)14-5-6(11)12/h3-4H,2,5H2,1H3,(H,11,12)
InChIKeyJNEPRPOBKDACMB-UHFFFAOYSA-N
MW214.25 g/mol
LogP0.44
Rot. Bonds4

About 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid

2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid (PubChem CID 62938587) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid.

Molecular Properties

Compound Name2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid
PubChem CID62938587
Molecular FormulaC8H10N2O3S
Molecular Weight214.25 g/mol
Exact Mass214.04
IUPAC Name2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid
SMILESCCn1ccnc(SCC(=O)O)c1=O
InChIInChI=1S/C8H10N2O3S/c1-2-10-4-3-9-7(8(10)13)14-5-6(11)12/h3-4H,2,5H2,1H3,(H,11,12)
InChIKeyJNEPRPOBKDACMB-UHFFFAOYSA-N
XLogP0.44
TPSA72.19 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.25
LogP ≤ 50.44
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid?
The IUPAC name of 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid (CID 62938587) is 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid.
What is the SMILES notation for 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid?
The canonical SMILES for 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid is CCn1ccnc(SCC(=O)O)c1=O.
What is the InChIKey of 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid?
The InChIKey is JNEPRPOBKDACMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-2-10-4-3-9-7(8(10)13)14-5-6(11)12/h3-4H,2,5H2,1H3,(H,11,12).
What are the key properties of 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid?
2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid has a molecular weight of 214.25 g/mol, XLogP of 0.44, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-3-oxopyrazin-2-yl)sulfanylacetic acid is sourced from PubChem (CID 62938587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).