About 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one
3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one (PubChem CID 62939102) has the molecular formula C14H23N5O
and a molecular weight of 277.37 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one.
Molecular Properties
| Compound Name | 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one |
| PubChem CID | 62939102 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one |
| SMILES | NCCN1CCCN(c2nccn(C3CC3)c2=O)CC1 |
| InChI | InChI=1S/C14H23N5O/c15-4-8-17-6-1-7-18(11-10-17)13-14(20)19(9-5-16-13)12-2-3-12/h5,9,12H,1-4,6-8,10-11,15H2 |
| InChIKey | OZBKCHJQDVSNSO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one?
The IUPAC name of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one (CID 62939102) is 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one.
What is the SMILES notation for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one?
The canonical SMILES for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one is NCCN1CCCN(c2nccn(C3CC3)c2=O)CC1.
What is the InChIKey of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one?
The InChIKey is OZBKCHJQDVSNSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O/c15-4-8-17-6-1-7-18(11-10-17)13-14(20)19(9-5-16-13)12-2-3-12/h5,9,12H,1-4,6-8,10-11,15H2.
What are the key properties of 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one?
3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one has a molecular weight of 277.37 g/mol, XLogP of 0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2-aminoethyl)-1,4-diazepan-1-yl]-1-cyclopropylpyrazin-2-one is sourced from PubChem (CID 62939102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).