C10H17N5O — CID 62940592
3-[ethyl-(4-methyl-3-oxopyrazin-2-yl)amino]propanimidamide (PubChem CID 62940592) has the molecular formula C10H17N5O and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-[ethyl-(4-methyl-3-oxopyrazin-2-yl)amino]propanimidamide.
| Compound Name | 3-[ethyl-(4-methyl-3-oxopyrazin-2-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 62940592 |
| Molecular Formula | C10H17N5O |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 3-[ethyl-(4-methyl-3-oxopyrazin-2-yl)amino]propanimidamide |
| SMILES | [H]/N=C(\N)CCN(CC)c1nccn(C)c1=O |
| InChI | InChI=1S/C10H17N5O/c1-3-15(6-4-8(11)12)9-10(16)14(2)7-5-13-9/h5,7H,3-4,6H2,1-2H3,(H3,11,12) |
| InChIKey | KBTICZMQSNPMRG-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|