C13H20N4O — CID 62940977
3-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methylpyrazin-2-one (PubChem CID 62940977) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methylpyrazin-2-one.
| Compound Name | 3-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 62940977 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 3-[(3aR,7aS)-5-amino-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N2C[C@H]3CCC(N)C[C@H]3C2)c1=O |
| InChI | InChI=1S/C13H20N4O/c1-16-5-4-15-12(13(16)18)17-7-9-2-3-11(14)6-10(9)8-17/h4-5,9-11H,2-3,6-8,14H2,1H3/t9-,10+,11?/m1/s1 |
| InChIKey | QXJZZCPTLCSGKX-JKIOLJMWSA-N |
| XLogP | 0.34 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |