About 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide
5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide (PubChem CID 62941476) has the molecular formula C15H22N4O2
and a molecular weight of 290.37 g/mol. Its IUPAC name is 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide.
Molecular Properties
| Compound Name | 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide |
| PubChem CID | 62941476 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide |
| SMILES | CC(CC(N)=O)CC(N)c1ccc2c(c1)n(C)c(=O)n2C |
| InChI | InChI=1S/C15H22N4O2/c1-9(7-14(17)20)6-11(16)10-4-5-12-13(8-10)19(3)15(21)18(12)2/h4-5,8-9,11H,6-7,16H2,1-3H3,(H2,17,20) |
| InChIKey | GQXRSVWGMJPVAO-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide?
The IUPAC name of 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide (CID 62941476) is 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide.
What is the SMILES notation for 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide?
The canonical SMILES for 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide is CC(CC(N)=O)CC(N)c1ccc2c(c1)n(C)c(=O)n2C.
What is the InChIKey of 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide?
The InChIKey is GQXRSVWGMJPVAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4O2/c1-9(7-14(17)20)6-11(16)10-4-5-12-13(8-10)19(3)15(21)18(12)2/h4-5,8-9,11H,6-7,16H2,1-3H3,(H2,17,20).
What are the key properties of 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide?
5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide has a molecular weight of 290.37 g/mol, XLogP of 0.78, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-5-(1,3-dimethyl-2-oxobenzimidazol-5-yl)-3-methylpentanamide is sourced from PubChem (CID 62941476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).