About 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol
1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol (PubChem CID 62941558) has the molecular formula C7H9ClN2O3S2
and a molecular weight of 268.75 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol |
| PubChem CID | 62941558 |
| Molecular Formula | C7H9ClN2O3S2 |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol |
| SMILES | O=S(=O)(c1cnc(Cl)s1)N1CCC(O)C1 |
| InChI | InChI=1S/C7H9ClN2O3S2/c8-7-9-3-6(14-7)15(12,13)10-2-1-5(11)4-10/h3,5,11H,1-2,4H2 |
| InChIKey | RPUKROJHKTWPHP-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol (CID 62941558) is 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol is O=S(=O)(c1cnc(Cl)s1)N1CCC(O)C1.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol?
The InChIKey is RPUKROJHKTWPHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O3S2/c8-7-9-3-6(14-7)15(12,13)10-2-1-5(11)4-10/h3,5,11H,1-2,4H2.
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol?
1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol has a molecular weight of 268.75 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]pyrrolidin-3-ol is sourced from PubChem (CID 62941558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).