C13H14BrFN2O4 — CID 62941863
5-[(4-bromo-2-fluorophenyl)carbamoylamino]-3-methyl-5-oxopentanoic acid (PubChem CID 62941863) has the molecular formula C13H14BrFN2O4 and a molecular weight of 361.17 g/mol. Its IUPAC name is 5-[(4-bromo-2-fluorophenyl)carbamoylamino]-3-methyl-5-oxopentanoic acid.
| Compound Name | 5-[(4-bromo-2-fluorophenyl)carbamoylamino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 62941863 |
| Molecular Formula | C13H14BrFN2O4 |
| Molecular Weight | 361.17 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 5-[(4-bromo-2-fluorophenyl)carbamoylamino]-3-methyl-5-oxopentanoic acid |
| SMILES | CC(CC(=O)O)CC(=O)NC(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H14BrFN2O4/c1-7(5-12(19)20)4-11(18)17-13(21)16-10-3-2-8(14)6-9(10)15/h2-3,6-7H,4-5H2,1H3,(H,19,20)(H2,16,17,18,21) |
| InChIKey | FFWYDYWLJBBEPA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.17 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |