C16H21N3OS — CID 62942007
5-benzyl-N-(2-methoxyethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine (PubChem CID 62942007) has the molecular formula C16H21N3OS and a molecular weight of 303.43 g/mol. Its IUPAC name is 5-benzyl-N-(2-methoxyethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine.
| Compound Name | 5-benzyl-N-(2-methoxyethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine |
|---|---|
| PubChem CID | 62942007 |
| Molecular Formula | C16H21N3OS |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-benzyl-N-(2-methoxyethyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-amine |
| SMILES | COCCNc1nc2c(s1)CN(Cc1ccccc1)CC2 |
| InChI | InChI=1S/C16H21N3OS/c1-20-10-8-17-16-18-14-7-9-19(12-15(14)21-16)11-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,17,18) |
| InChIKey | DJZGSWVTVQEOEJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|