About 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol
1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol (PubChem CID 62942060) has the molecular formula C8H15F3N2O
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol.
Molecular Properties
| Compound Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol |
| PubChem CID | 62942060 |
| Molecular Formula | C8H15F3N2O |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol |
| SMILES | NCCC(N1CCC(O)C1)C(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O/c9-8(10,11)7(1-3-12)13-4-2-6(14)5-13/h6-7,14H,1-5,12H2 |
| InChIKey | DTCSPHBCMLSTME-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol?
The IUPAC name of 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol (CID 62942060) is 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol.
What is the SMILES notation for 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol?
The canonical SMILES for 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol is NCCC(N1CCC(O)C1)C(F)(F)F.
What is the InChIKey of 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol?
The InChIKey is DTCSPHBCMLSTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F3N2O/c9-8(10,11)7(1-3-12)13-4-2-6(14)5-13/h6-7,14H,1-5,12H2.
What are the key properties of 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol?
1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol has a molecular weight of 212.21 g/mol, XLogP of 0.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1,1,1-trifluorobutan-2-yl)pyrrolidin-3-ol is sourced from PubChem (CID 62942060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).