C14H21FN2O3 — CID 62942200
5-amino-5-(2-fluoro-4,5-dimethoxyphenyl)-3-methylpentanamide (PubChem CID 62942200) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 5-amino-5-(2-fluoro-4,5-dimethoxyphenyl)-3-methylpentanamide.
| Compound Name | 5-amino-5-(2-fluoro-4,5-dimethoxyphenyl)-3-methylpentanamide |
|---|---|
| PubChem CID | 62942200 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-amino-5-(2-fluoro-4,5-dimethoxyphenyl)-3-methylpentanamide |
| SMILES | COc1cc(F)c(C(N)CC(C)CC(N)=O)cc1OC |
| InChI | InChI=1S/C14H21FN2O3/c1-8(5-14(17)18)4-11(16)9-6-12(19-2)13(20-3)7-10(9)15/h6-8,11H,4-5,16H2,1-3H3,(H2,17,18) |
| InChIKey | VTRWGKNPHMNRIO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |