C12H15N3S — CID 62942552
N-tert-butyl-4-pyridin-3-yl-1,3-thiazol-2-amine (PubChem CID 62942552) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is N-tert-butyl-4-pyridin-3-yl-1,3-thiazol-2-amine.
| Compound Name | N-tert-butyl-4-pyridin-3-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 62942552 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | N-tert-butyl-4-pyridin-3-yl-1,3-thiazol-2-amine |
| SMILES | CC(C)(C)Nc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C12H15N3S/c1-12(2,3)15-11-14-10(8-16-11)9-5-4-6-13-7-9/h4-8H,1-3H3,(H,14,15) |
| InChIKey | VRUKBHHYXOFIIH-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |