C13H12ClNS — CID 62943470
2-chloro-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 62943470) has the molecular formula C13H12ClNS and a molecular weight of 249.77 g/mol. Its IUPAC name is 2-chloro-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-chloro-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 62943470 |
| Molecular Formula | C13H12ClNS |
| Molecular Weight | 249.77 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | 2-chloro-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | Clc1nc2c(s1)CC(c1ccccc1)CC2 |
| InChI | InChI=1S/C13H12ClNS/c14-13-15-11-7-6-10(8-12(11)16-13)9-4-2-1-3-5-9/h1-5,10H,6-8H2 |
| InChIKey | KDDKQSDBIDUWSE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |