C8H4N6O4 — CID 62944634
5-(5-nitrofuran-2-yl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole (PubChem CID 62944634) has the molecular formula C8H4N6O4 and a molecular weight of 248.16 g/mol. Its IUPAC name is 5-(5-nitrofuran-2-yl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(5-nitrofuran-2-yl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62944634 |
| Molecular Formula | C8H4N6O4 |
| Molecular Weight | 248.16 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 5-(5-nitrofuran-2-yl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole |
| SMILES | O=[N+]([O-])c1ccc(-c2nc(-c3ncn[nH]3)no2)o1 |
| InChI | InChI=1S/C8H4N6O4/c15-14(16)5-2-1-4(17-5)8-11-7(13-18-8)6-9-3-10-12-6/h1-3H,(H,9,10,12) |
| InChIKey | AMJFMIOFRZZONV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 136.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.16 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|