About N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide
N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide (PubChem CID 62946140) has the molecular formula C6H11N5O3S
and a molecular weight of 233.25 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide.
Molecular Properties
| Compound Name | N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide |
| PubChem CID | 62946140 |
| Molecular Formula | C6H11N5O3S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide |
| SMILES | O=S(=O)(Nc1ncn[nH]1)N1CCOCC1 |
| InChI | InChI=1S/C6H11N5O3S/c12-15(13,10-6-7-5-8-9-6)11-1-3-14-4-2-11/h5H,1-4H2,(H2,7,8,9,10) |
| InChIKey | JGROFWQAUKRWQN-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide?
The IUPAC name of N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide (CID 62946140) is N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide.
What is the SMILES notation for N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide?
The canonical SMILES for N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide is O=S(=O)(Nc1ncn[nH]1)N1CCOCC1.
What is the InChIKey of N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide?
The InChIKey is JGROFWQAUKRWQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N5O3S/c12-15(13,10-6-7-5-8-9-6)11-1-3-14-4-2-11/h5H,1-4H2,(H2,7,8,9,10).
What are the key properties of N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide?
N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide has a molecular weight of 233.25 g/mol, XLogP of -1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-1,2,4-triazol-5-yl)morpholine-4-sulfonamide is sourced from PubChem (CID 62946140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).