About 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide
2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide (PubChem CID 62946305) has the molecular formula C5H10N4O3S
and a molecular weight of 206.23 g/mol. Its IUPAC name is 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
| PubChem CID | 62946305 |
| Molecular Formula | C5H10N4O3S |
| Molecular Weight | 206.23 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide |
| SMILES | COCCS(=O)(=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C5H10N4O3S/c1-12-2-3-13(10,11)9-5-6-4-7-8-5/h4H,2-3H2,1H3,(H2,6,7,8,9) |
| InChIKey | OBHABVDWUXFDRP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.23 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The IUPAC name of 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide (CID 62946305) is 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide.
What is the SMILES notation for 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The canonical SMILES for 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide is COCCS(=O)(=O)Nc1ncn[nH]1.
What is the InChIKey of 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
The InChIKey is OBHABVDWUXFDRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4O3S/c1-12-2-3-13(10,11)9-5-6-4-7-8-5/h4H,2-3H2,1H3,(H2,6,7,8,9).
What are the key properties of 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide?
2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide has a molecular weight of 206.23 g/mol, XLogP of -0.81, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-(1H-1,2,4-triazol-5-yl)ethanesulfonamide is sourced from PubChem (CID 62946305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).