C18H21F6NO3 — CID 629465
ethyl 5-[ethyl(1-phenylpropan-2-yl)amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate (PubChem CID 629465) has the molecular formula C18H21F6NO3 and a molecular weight of 413.36 g/mol. Its IUPAC name is ethyl 5-[ethyl(1-phenylpropan-2-yl)amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate.
| Compound Name | ethyl 5-[ethyl(1-phenylpropan-2-yl)amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
|---|---|
| PubChem CID | 629465 |
| Molecular Formula | C18H21F6NO3 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | ethyl 5-[ethyl(1-phenylpropan-2-yl)amino]-2,2,3,3,4,4-hexafluoro-5-oxopentanoate |
| SMILES | CCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)N(CC)C(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H21F6NO3/c1-4-25(12(3)11-13-9-7-6-8-10-13)14(26)16(19,20)18(23,24)17(21,22)15(27)28-5-2/h6-10,12H,4-5,11H2,1-3H3 |
| InChIKey | JRVVLQNSXIPRHE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|