C14H28B2O3Si2 — CID 629479
4-ethyl-5-[(4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborol-5-yl)oxy]-2,2,3-trimethyl-1,2,5-oxasilaborole (PubChem CID 629479) has the molecular formula C14H28B2O3Si2 and a molecular weight of 322.17 g/mol. Its IUPAC name is 4-ethyl-5-[(4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborol-5-yl)oxy]-2,2,3-trimethyl-1,2,5-oxasilaborole.
| Compound Name | 4-ethyl-5-[(4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborol-5-yl)oxy]-2,2,3-trimethyl-1,2,5-oxasilaborole |
|---|---|
| PubChem CID | 629479 |
| Molecular Formula | C14H28B2O3Si2 |
| Molecular Weight | 322.17 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 4-ethyl-5-[(4-ethyl-2,2,3-trimethyl-1,2,5-oxasilaborol-5-yl)oxy]-2,2,3-trimethyl-1,2,5-oxasilaborole |
| SMILES | CCC1=C(C)[Si](C)(C)OB1OB1O[Si](C)(C)C(C)=C1CC |
| InChI | InChI=1S/C14H28B2O3Si2/c1-9-13-11(3)20(5,6)18-15(13)17-16-14(10-2)12(4)21(7,8)19-16/h9-10H2,1-8H3 |
| InChIKey | OBIPVJIYCCJKIF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.17 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|