C10H11ClF3N3 — CID 62948022
2-chloro-4-[methyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide (PubChem CID 62948022) has the molecular formula C10H11ClF3N3 and a molecular weight of 265.67 g/mol. Its IUPAC name is 2-chloro-4-[methyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide.
| Compound Name | 2-chloro-4-[methyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62948022 |
| Molecular Formula | C10H11ClF3N3 |
| Molecular Weight | 265.67 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-chloro-4-[methyl(2,2,2-trifluoroethyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N(C)CC(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H11ClF3N3/c1-17(5-10(12,13)14)6-2-3-7(9(15)16)8(11)4-6/h2-4H,5H2,1H3,(H3,15,16) |
| InChIKey | RGIUDZKFNWSOST-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|