C6H8F7NO — CID 62948392
2-amino-4,4,5,5,6,6,6-heptafluorohexan-3-ol (PubChem CID 62948392) has the molecular formula C6H8F7NO and a molecular weight of 243.12 g/mol. Its IUPAC name is 2-amino-4,4,5,5,6,6,6-heptafluorohexan-3-ol.
| Compound Name | 2-amino-4,4,5,5,6,6,6-heptafluorohexan-3-ol |
|---|---|
| PubChem CID | 62948392 |
| Molecular Formula | C6H8F7NO |
| Molecular Weight | 243.12 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-amino-4,4,5,5,6,6,6-heptafluorohexan-3-ol |
| SMILES | CC(N)C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F7NO/c1-2(14)3(15)4(7,8)5(9,10)6(11,12)13/h2-3,15H,14H2,1H3 |
| InChIKey | JRAGLFPCCTUAAH-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.12 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|