About (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine
(1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine (PubChem CID 62949601) has the molecular formula C7H8N6
and a molecular weight of 176.18 g/mol. Its IUPAC name is (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine.
Molecular Properties
| Compound Name | (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine |
| PubChem CID | 62949601 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine |
| SMILES | NCc1ncn(-c2cnccn2)n1 |
| InChI | InChI=1S/C7H8N6/c8-3-6-11-5-13(12-6)7-4-9-1-2-10-7/h1-2,4-5H,3,8H2 |
| InChIKey | MMFTYXWLRWCQRI-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine?
The IUPAC name of (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine (CID 62949601) is (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine.
What is the SMILES notation for (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine?
The canonical SMILES for (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine is NCc1ncn(-c2cnccn2)n1.
What is the InChIKey of (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine?
The InChIKey is MMFTYXWLRWCQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N6/c8-3-6-11-5-13(12-6)7-4-9-1-2-10-7/h1-2,4-5H,3,8H2.
What are the key properties of (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine?
(1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine has a molecular weight of 176.18 g/mol, XLogP of -0.48, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-pyrazin-2-yl-1,2,4-triazol-3-yl)methanamine is sourced from PubChem (CID 62949601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).