C16H17N3O2 — CID 62949892
3-N-[[2-(aminomethyl)phenyl]methyl]benzene-1,3-dicarboxamide (PubChem CID 62949892) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-N-[[2-(aminomethyl)phenyl]methyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[[2-(aminomethyl)phenyl]methyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 62949892 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-N-[[2-(aminomethyl)phenyl]methyl]benzene-1,3-dicarboxamide |
| SMILES | NCc1ccccc1CNC(=O)c1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C16H17N3O2/c17-9-13-4-1-2-5-14(13)10-19-16(21)12-7-3-6-11(8-12)15(18)20/h1-8H,9-10,17H2,(H2,18,20)(H,19,21) |
| InChIKey | GCMQUTVMYVRZOI-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |