About 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide
1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide (PubChem CID 62950715) has the molecular formula C7H12N4OS
and a molecular weight of 200.27 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide.
Molecular Properties
| Compound Name | 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide |
| PubChem CID | 62950715 |
| Molecular Formula | C7H12N4OS |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide |
| SMILES | CCOCCn1cnc(C(N)=S)n1 |
| InChI | InChI=1S/C7H12N4OS/c1-2-12-4-3-11-5-9-7(10-11)6(8)13/h5H,2-4H2,1H3,(H2,8,13) |
| InChIKey | WTFLASVHQXNCDR-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide?
The IUPAC name of 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide (CID 62950715) is 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide.
What is the SMILES notation for 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide?
The canonical SMILES for 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide is CCOCCn1cnc(C(N)=S)n1.
What is the InChIKey of 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide?
The InChIKey is WTFLASVHQXNCDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4OS/c1-2-12-4-3-11-5-9-7(10-11)6(8)13/h5H,2-4H2,1H3,(H2,8,13).
What are the key properties of 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide?
1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide has a molecular weight of 200.27 g/mol, XLogP of -0.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxyethyl)-1,2,4-triazole-3-carbothioamide is sourced from PubChem (CID 62950715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).