About 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide
2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide (PubChem CID 62950901) has the molecular formula C8H13N5O2S
and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide |
| PubChem CID | 62950901 |
| Molecular Formula | C8H13N5O2S |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cnc(C(N)=S)n1 |
| InChI | InChI=1S/C8H13N5O2S/c1-15-3-2-10-6(14)4-13-5-11-8(12-13)7(9)16/h5H,2-4H2,1H3,(H2,9,16)(H,10,14) |
| InChIKey | DMOXQRZSGOGILF-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide?
The IUPAC name of 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide (CID 62950901) is 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide.
What is the SMILES notation for 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide?
The canonical SMILES for 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide is COCCNC(=O)Cn1cnc(C(N)=S)n1.
What is the InChIKey of 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide?
The InChIKey is DMOXQRZSGOGILF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N5O2S/c1-15-3-2-10-6(14)4-13-5-11-8(12-13)7(9)16/h5H,2-4H2,1H3,(H2,9,16)(H,10,14).
What are the key properties of 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide?
2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide has a molecular weight of 243.29 g/mol, XLogP of -1.33, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-carbamothioyl-1,2,4-triazol-1-yl)-N-(2-methoxyethyl)acetamide is sourced from PubChem (CID 62950901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).