C5H6F2N4S — CID 62951450
1-(2,2-difluoroethyl)-1,2,4-triazole-3-carbothioamide (PubChem CID 62951450) has the molecular formula C5H6F2N4S and a molecular weight of 192.19 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-1,2,4-triazole-3-carbothioamide.
| Compound Name | 1-(2,2-difluoroethyl)-1,2,4-triazole-3-carbothioamide |
|---|---|
| PubChem CID | 62951450 |
| Molecular Formula | C5H6F2N4S |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1-(2,2-difluoroethyl)-1,2,4-triazole-3-carbothioamide |
| SMILES | NC(=S)c1ncn(CC(F)F)n1 |
| InChI | InChI=1S/C5H6F2N4S/c6-3(7)1-11-2-9-5(10-11)4(8)12/h2-3H,1H2,(H2,8,12) |
| InChIKey | AGEDOURZCGJUOH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|