About 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile
1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 62951995) has the molecular formula C6H7ClN4
and a molecular weight of 170.60 g/mol. Its IUPAC name is 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 62951995 |
| Molecular Formula | C6H7ClN4 |
| Molecular Weight | 170.60 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | N#Cc1ncn(CCCCl)n1 |
| InChI | InChI=1S/C6H7ClN4/c7-2-1-3-11-5-9-6(4-8)10-11/h5H,1-3H2 |
| InChIKey | SRQNLNUDOWYMBW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.60 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile (CID 62951995) is 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile is N#Cc1ncn(CCCCl)n1.
What is the InChIKey of 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile?
The InChIKey is SRQNLNUDOWYMBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN4/c7-2-1-3-11-5-9-6(4-8)10-11/h5H,1-3H2.
What are the key properties of 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile?
1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile has a molecular weight of 170.60 g/mol, XLogP of 0.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 62951995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).