About 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide
2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide (PubChem CID 62952007) has the molecular formula C7H9N5O2
and a molecular weight of 195.18 g/mol. Its IUPAC name is 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide.
Molecular Properties
| Compound Name | 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide |
| PubChem CID | 62952007 |
| Molecular Formula | C7H9N5O2 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide |
| SMILES | N#Cc1ncn(CC(=O)NCCO)n1 |
| InChI | InChI=1S/C7H9N5O2/c8-3-6-10-5-12(11-6)4-7(14)9-1-2-13/h5,13H,1-2,4H2,(H,9,14) |
| InChIKey | YQUIOKBUTCZWSQ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide?
The IUPAC name of 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide (CID 62952007) is 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide.
What is the SMILES notation for 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide?
The canonical SMILES for 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide is N#Cc1ncn(CC(=O)NCCO)n1.
What is the InChIKey of 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide?
The InChIKey is YQUIOKBUTCZWSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N5O2/c8-3-6-10-5-12(11-6)4-7(14)9-1-2-13/h5,13H,1-2,4H2,(H,9,14).
What are the key properties of 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide?
2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide has a molecular weight of 195.18 g/mol, XLogP of -1.74, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyano-1,2,4-triazol-1-yl)-N-(2-hydroxyethyl)acetamide is sourced from PubChem (CID 62952007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).