C11H8Br2ClN3O2S — CID 62955473
3-amino-2-bromo-N-(5-bromo-2-pyridinyl)-5-chlorobenzenesulfonamide (PubChem CID 62955473) has the molecular formula C11H8Br2ClN3O2S and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-amino-2-bromo-N-(5-bromo-2-pyridinyl)-5-chlorobenzenesulfonamide.
| Compound Name | 3-amino-2-bromo-N-(5-bromo-2-pyridinyl)-5-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 62955473 |
| Molecular Formula | C11H8Br2ClN3O2S |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 438.84 |
| IUPAC Name | 3-amino-2-bromo-N-(5-bromo-2-pyridinyl)-5-chlorobenzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(S(=O)(=O)Nc2ccc(Br)cn2)c1Br |
| InChI | InChI=1S/C11H8Br2ClN3O2S/c12-6-1-2-10(16-5-6)17-20(18,19)9-4-7(14)3-8(15)11(9)13/h1-5H,15H2,(H,16,17) |
| InChIKey | YNNKZWJVVACFJT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|