C12H20N2O7 — CID 62956267
2-[bis(2-methoxy-2-oxoethyl)carbamoyl-propylamino]acetic acid (PubChem CID 62956267) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-[bis(2-methoxy-2-oxoethyl)carbamoyl-propylamino]acetic acid.
| Compound Name | 2-[bis(2-methoxy-2-oxoethyl)carbamoyl-propylamino]acetic acid |
|---|---|
| PubChem CID | 62956267 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-[bis(2-methoxy-2-oxoethyl)carbamoyl-propylamino]acetic acid |
| SMILES | CCCN(CC(=O)O)C(=O)N(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C12H20N2O7/c1-4-5-13(6-9(15)16)12(19)14(7-10(17)20-2)8-11(18)21-3/h4-8H2,1-3H3,(H,15,16) |
| InChIKey | QAWBCTCRQVBVGO-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |