C12H16BrN3O — CID 62957995
[2-(aminomethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone (PubChem CID 62957995) has the molecular formula C12H16BrN3O and a molecular weight of 298.18 g/mol. Its IUPAC name is [2-(aminomethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone.
| Compound Name | [2-(aminomethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 62957995 |
| Molecular Formula | C12H16BrN3O |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | [2-(aminomethyl)piperidin-1-yl]-(5-bromo-2-pyridinyl)methanone |
| SMILES | NCC1CCCCN1C(=O)c1ccc(Br)cn1 |
| InChI | InChI=1S/C12H16BrN3O/c13-9-4-5-11(15-8-9)12(17)16-6-2-1-3-10(16)7-14/h4-5,8,10H,1-3,6-7,14H2 |
| InChIKey | ROYXCYYJVLSJBV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |