About 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine
5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (PubChem CID 62958831) has the molecular formula C8H7BrN4
and a molecular weight of 239.08 g/mol. Its IUPAC name is 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| PubChem CID | 62958831 |
| Molecular Formula | C8H7BrN4 |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 237.99 |
| IUPAC Name | 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine |
| SMILES | Cc1nc(-c2ccc(Br)cn2)n[nH]1 |
| InChI | InChI=1S/C8H7BrN4/c1-5-11-8(13-12-5)7-3-2-6(9)4-10-7/h2-4H,1H3,(H,11,12,13) |
| InChIKey | JXIMENQPNOTKHN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The IUPAC name of 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine (CID 62958831) is 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine.
What is the SMILES notation for 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The canonical SMILES for 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is Cc1nc(-c2ccc(Br)cn2)n[nH]1.
What is the InChIKey of 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
The InChIKey is JXIMENQPNOTKHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN4/c1-5-11-8(13-12-5)7-3-2-6(9)4-10-7/h2-4H,1H3,(H,11,12,13).
What are the key properties of 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine?
5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine has a molecular weight of 239.08 g/mol, XLogP of 1.94, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-(5-methyl-1H-1,2,4-triazol-3-yl)pyridine is sourced from PubChem (CID 62958831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).