C31H23N3O4S — CID 6296055
(4E)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6296055) has the molecular formula C31H23N3O4S and a molecular weight of 533.61 g/mol. Its IUPAC name is (4E)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6296055 |
| Molecular Formula | C31H23N3O4S |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (4E)-4-[hydroxy(pyridin-4-yl)methylidene]-1-(6-methyl-1,3-benzothiazol-2-yl)-5-(4-phenylmethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccncc4)C3c3ccc(OCc4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C31H23N3O4S/c1-19-7-12-24-25(17-19)39-31(33-24)34-27(26(29(36)30(34)37)28(35)22-13-15-32-16-14-22)21-8-10-23(11-9-21)38-18-20-5-3-2-4-6-20/h2-17,27,35H,18H2,1H3/b28-26+ |
| InChIKey | WOGPFLUMDPYAHE-BYCLXTJYSA-N |
| XLogP | 6.21 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|